About 4-fluoro-3-methoxy-1,2-di(propan-2-yl)pyrrolidine
4-fluoro-3-methoxy-1,2-di(propan-2-yl)pyrrolidine (PubChem CID 129229279) has the molecular formula C11H22FNO
and a molecular weight of 203.30 g/mol. Its IUPAC name is 4-fluoro-3-methoxy-1,2-di(propan-2-yl)pyrrolidine.
Molecular Properties
| Compound Name | 4-fluoro-3-methoxy-1,2-di(propan-2-yl)pyrrolidine |
| PubChem CID | 129229279 |
| Molecular Formula | C11H22FNO |
| Molecular Weight | 203.30 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 4-fluoro-3-methoxy-1,2-di(propan-2-yl)pyrrolidine |
| SMILES | COC1C(F)CN(C(C)C)C1C(C)C |
| InChI | InChI=1S/C11H22FNO/c1-7(2)10-11(14-5)9(12)6-13(10)8(3)4/h7-11H,6H2,1-5H3 |
| InChIKey | ANIGKSQIFAXOPY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-fluoro-3-methoxy-1,2-di(propan-2-yl)pyrrolidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-fluoro-3-methoxy-1,2-di(propan-2-yl)pyrrolidine?
The IUPAC name of 4-fluoro-3-methoxy-1,2-di(propan-2-yl)pyrrolidine (CID 129229279) is 4-fluoro-3-methoxy-1,2-di(propan-2-yl)pyrrolidine.
What is the SMILES notation for 4-fluoro-3-methoxy-1,2-di(propan-2-yl)pyrrolidine?
The canonical SMILES for 4-fluoro-3-methoxy-1,2-di(propan-2-yl)pyrrolidine is COC1C(F)CN(C(C)C)C1C(C)C.
What is the InChIKey of 4-fluoro-3-methoxy-1,2-di(propan-2-yl)pyrrolidine?
The InChIKey is ANIGKSQIFAXOPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22FNO/c1-7(2)10-11(14-5)9(12)6-13(10)8(3)4/h7-11H,6H2,1-5H3.
What are the key properties of 4-fluoro-3-methoxy-1,2-di(propan-2-yl)pyrrolidine?
4-fluoro-3-methoxy-1,2-di(propan-2-yl)pyrrolidine has a molecular weight of 203.30 g/mol, XLogP of 2.09, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-fluoro-3-methoxy-1,2-di(propan-2-yl)pyrrolidine is sourced from PubChem (CID 129229279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).