C23H23ClN6O5 — CID 129229662
1-[2-[(1S,4S,6R,7S)-3-[(6-chloro-2-pyridinyl)methylcarbamoyl]-6,7-dihydroxy-2-azabicyclo[2.2.1]heptan-2-yl]-2-oxoethyl]indazole-3-carboxamide (PubChem CID 129229662) has the molecular formula C23H23ClN6O5 and a molecular weight of 498.93 g/mol. Its IUPAC name is 1-[2-[(1S,4S,6R,7S)-3-[(6-chloro-2-pyridinyl)methylcarbamoyl]-6,7-dihydroxy-2-azabicyclo[2.2.1]heptan-2-yl]-2-oxoethyl]indazole-3-carboxamide.
| Compound Name | 1-[2-[(1S,4S,6R,7S)-3-[(6-chloro-2-pyridinyl)methylcarbamoyl]-6,7-dihydroxy-2-azabicyclo[2.2.1]heptan-2-yl]-2-oxoethyl]indazole-3-carboxamide |
|---|---|
| PubChem CID | 129229662 |
| Molecular Formula | C23H23ClN6O5 |
| Molecular Weight | 498.93 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | 1-[2-[(1S,4S,6R,7S)-3-[(6-chloro-2-pyridinyl)methylcarbamoyl]-6,7-dihydroxy-2-azabicyclo[2.2.1]heptan-2-yl]-2-oxoethyl]indazole-3-carboxamide |
| SMILES | NC(=O)c1nn(CC(=O)N2C(C(=O)NCc3cccc(Cl)n3)[C@@H]3C[C@@H](O)[C@H]2[C@H]3O)c2ccccc12 |
| InChI | InChI=1S/C23H23ClN6O5/c24-16-7-3-4-11(27-16)9-26-23(35)19-13-8-15(31)20(21(13)33)30(19)17(32)10-29-14-6-2-1-5-12(14)18(28-29)22(25)34/h1-7,13,15,19-21,31,33H,8-10H2,(H2,25,34)(H,26,35)/t13-,15+,19?,20-,21-/m0/s1 |
| InChIKey | TYDLBRCWBXFXLA-VIJRWGNNSA-N |
| XLogP | -0.18 |
| TPSA | 163.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.93 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|