About methyl 3-acetamido-5-(acetamidomethyl)-2,4,6-triiodobenzoate
methyl 3-acetamido-5-(acetamidomethyl)-2,4,6-triiodobenzoate (PubChem CID 12923) has the molecular formula C13H13I3N2O4
and a molecular weight of 641.97 g/mol. Its IUPAC name is methyl 3-acetamido-5-(acetamidomethyl)-2,4,6-triiodobenzoate.
Molecular Properties
| Compound Name | methyl 3-acetamido-5-(acetamidomethyl)-2,4,6-triiodobenzoate |
| PubChem CID | 12923 |
| Molecular Formula | C13H13I3N2O4 |
| Molecular Weight | 641.97 g/mol |
| Exact Mass | 641.80 |
| IUPAC Name | methyl 3-acetamido-5-(acetamidomethyl)-2,4,6-triiodobenzoate |
| SMILES | COC(=O)c1c(I)c(CNC(C)=O)c(I)c(NC(C)=O)c1I |
| InChI | InChI=1S/C13H13I3N2O4/c1-5(19)17-4-7-9(14)8(13(21)22-3)11(16)12(10(7)15)18-6(2)20/h4H2,1-3H3,(H,17,19)(H,18,20) |
| InChIKey | QFMJCLURWFGWEE-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 641.97 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-acetamido-5-(acetamidomethyl)-2,4,6-triiodobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-acetamido-5-(acetamidomethyl)-2,4,6-triiodobenzoate?
The IUPAC name of methyl 3-acetamido-5-(acetamidomethyl)-2,4,6-triiodobenzoate (CID 12923) is methyl 3-acetamido-5-(acetamidomethyl)-2,4,6-triiodobenzoate.
What is the SMILES notation for methyl 3-acetamido-5-(acetamidomethyl)-2,4,6-triiodobenzoate?
The canonical SMILES for methyl 3-acetamido-5-(acetamidomethyl)-2,4,6-triiodobenzoate is COC(=O)c1c(I)c(CNC(C)=O)c(I)c(NC(C)=O)c1I.
What is the InChIKey of methyl 3-acetamido-5-(acetamidomethyl)-2,4,6-triiodobenzoate?
The InChIKey is QFMJCLURWFGWEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13I3N2O4/c1-5(19)17-4-7-9(14)8(13(21)22-3)11(16)12(10(7)15)18-6(2)20/h4H2,1-3H3,(H,17,19)(H,18,20).
What are the key properties of methyl 3-acetamido-5-(acetamidomethyl)-2,4,6-triiodobenzoate?
methyl 3-acetamido-5-(acetamidomethyl)-2,4,6-triiodobenzoate has a molecular weight of 641.97 g/mol, XLogP of 2.88, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-acetamido-5-(acetamidomethyl)-2,4,6-triiodobenzoate is sourced from PubChem (CID 12923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).