About 5-pyrrolidin-1-ylpyrazolo[1,5-a]pyrimidin-3-amine
5-pyrrolidin-1-ylpyrazolo[1,5-a]pyrimidin-3-amine (PubChem CID 129230006) has the molecular formula C10H13N5
and a molecular weight of 203.25 g/mol. Its IUPAC name is 5-pyrrolidin-1-ylpyrazolo[1,5-a]pyrimidin-3-amine.
Molecular Properties
| Compound Name | 5-pyrrolidin-1-ylpyrazolo[1,5-a]pyrimidin-3-amine |
| PubChem CID | 129230006 |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.25 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | 5-pyrrolidin-1-ylpyrazolo[1,5-a]pyrimidin-3-amine |
| SMILES | Nc1cnn2ccc(N3CCCC3)nc12 |
| InChI | InChI=1S/C10H13N5/c11-8-7-12-15-6-3-9(13-10(8)15)14-4-1-2-5-14/h3,6-7H,1-2,4-5,11H2 |
| InChIKey | TZSINVMURBDRJB-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 59.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.25 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 5-pyrrolidin-1-ylpyrazolo[1,5-a]pyrimidin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-pyrrolidin-1-ylpyrazolo[1,5-a]pyrimidin-3-amine?
The IUPAC name of 5-pyrrolidin-1-ylpyrazolo[1,5-a]pyrimidin-3-amine (CID 129230006) is 5-pyrrolidin-1-ylpyrazolo[1,5-a]pyrimidin-3-amine.
What is the SMILES notation for 5-pyrrolidin-1-ylpyrazolo[1,5-a]pyrimidin-3-amine?
The canonical SMILES for 5-pyrrolidin-1-ylpyrazolo[1,5-a]pyrimidin-3-amine is Nc1cnn2ccc(N3CCCC3)nc12.
What is the InChIKey of 5-pyrrolidin-1-ylpyrazolo[1,5-a]pyrimidin-3-amine?
The InChIKey is TZSINVMURBDRJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N5/c11-8-7-12-15-6-3-9(13-10(8)15)14-4-1-2-5-14/h3,6-7H,1-2,4-5,11H2.
What are the key properties of 5-pyrrolidin-1-ylpyrazolo[1,5-a]pyrimidin-3-amine?
5-pyrrolidin-1-ylpyrazolo[1,5-a]pyrimidin-3-amine has a molecular weight of 203.25 g/mol, XLogP of 0.91, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-pyrrolidin-1-ylpyrazolo[1,5-a]pyrimidin-3-amine is sourced from PubChem (CID 129230006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).