About (5S)-6,6-difluoro-2-methyl-2,9-diazaspiro[4.5]decane
(5S)-6,6-difluoro-2-methyl-2,9-diazaspiro[4.5]decane (PubChem CID 129230060) has the molecular formula C9H16F2N2
and a molecular weight of 190.24 g/mol. Its IUPAC name is (5S)-6,6-difluoro-2-methyl-2,9-diazaspiro[4.5]decane.
Molecular Properties
| Compound Name | (5S)-6,6-difluoro-2-methyl-2,9-diazaspiro[4.5]decane |
| PubChem CID | 129230060 |
| Molecular Formula | C9H16F2N2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.13 |
| IUPAC Name | (5S)-6,6-difluoro-2-methyl-2,9-diazaspiro[4.5]decane |
| SMILES | CN1CC[C@]2(CNCCC2(F)F)C1 |
| InChI | InChI=1S/C9H16F2N2/c1-13-5-3-8(7-13)6-12-4-2-9(8,10)11/h12H,2-7H2,1H3/t8-/m0/s1 |
| InChIKey | FRYLXVILQIQAED-QMMMGPOBSA-N |
| XLogP | 0.94 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (5S)-6,6-difluoro-2-methyl-2,9-diazaspiro[4.5]decane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-6,6-difluoro-2-methyl-2,9-diazaspiro[4.5]decane?
The IUPAC name of (5S)-6,6-difluoro-2-methyl-2,9-diazaspiro[4.5]decane (CID 129230060) is (5S)-6,6-difluoro-2-methyl-2,9-diazaspiro[4.5]decane.
What is the SMILES notation for (5S)-6,6-difluoro-2-methyl-2,9-diazaspiro[4.5]decane?
The canonical SMILES for (5S)-6,6-difluoro-2-methyl-2,9-diazaspiro[4.5]decane is CN1CC[C@]2(CNCCC2(F)F)C1.
What is the InChIKey of (5S)-6,6-difluoro-2-methyl-2,9-diazaspiro[4.5]decane?
The InChIKey is FRYLXVILQIQAED-QMMMGPOBSA-N. The full InChI is InChI=1S/C9H16F2N2/c1-13-5-3-8(7-13)6-12-4-2-9(8,10)11/h12H,2-7H2,1H3/t8-/m0/s1.
What are the key properties of (5S)-6,6-difluoro-2-methyl-2,9-diazaspiro[4.5]decane?
(5S)-6,6-difluoro-2-methyl-2,9-diazaspiro[4.5]decane has a molecular weight of 190.24 g/mol, XLogP of 0.94, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-6,6-difluoro-2-methyl-2,9-diazaspiro[4.5]decane is sourced from PubChem (CID 129230060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).