C6H8N4O6 — CID 129230217
(2R,4R,5S)-3,4,5,6-tetranitrosocyclohexane-1,2-diol (PubChem CID 129230217) has the molecular formula C6H8N4O6 and a molecular weight of 232.15 g/mol. Its IUPAC name is (2R,4R,5S)-3,4,5,6-tetranitrosocyclohexane-1,2-diol.
| Compound Name | (2R,4R,5S)-3,4,5,6-tetranitrosocyclohexane-1,2-diol |
|---|---|
| PubChem CID | 129230217 |
| Molecular Formula | C6H8N4O6 |
| Molecular Weight | 232.15 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | (2R,4R,5S)-3,4,5,6-tetranitrosocyclohexane-1,2-diol |
| SMILES | O=NC1C(O)[C@H](O)C(N=O)[C@H](N=O)[C@@H]1N=O |
| InChI | InChI=1S/C6H8N4O6/c11-5-3(9-15)1(7-13)2(8-14)4(10-16)6(5)12/h1-6,11-12H/t1-,2+,3?,4?,5-,6?/m1/s1 |
| InChIKey | GEANEJZYGYPFOS-OBXALCGXSA-N |
| XLogP | -0.74 |
| TPSA | 158.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.15 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |