C16H34N2 — CID 129230490
N,N,N'-trimethyl-N'-(3,3,5,5-tetramethylhex-1-en-2-yl)propane-1,3-diamine (PubChem CID 129230490) has the molecular formula C16H34N2 and a molecular weight of 254.46 g/mol. Its IUPAC name is N,N,N'-trimethyl-N'-(3,3,5,5-tetramethylhex-1-en-2-yl)propane-1,3-diamine.
| Compound Name | N,N,N'-trimethyl-N'-(3,3,5,5-tetramethylhex-1-en-2-yl)propane-1,3-diamine |
|---|---|
| PubChem CID | 129230490 |
| Molecular Formula | C16H34N2 |
| Molecular Weight | 254.46 g/mol |
| Exact Mass | 254.27 |
| IUPAC Name | N,N,N'-trimethyl-N'-(3,3,5,5-tetramethylhex-1-en-2-yl)propane-1,3-diamine |
| SMILES | C=C(N(C)CCCN(C)C)C(C)(C)CC(C)(C)C |
| InChI | InChI=1S/C16H34N2/c1-14(16(5,6)13-15(2,3)4)18(9)12-10-11-17(7)8/h1,10-13H2,2-9H3 |
| InChIKey | AZLNJCVUSBEZEY-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.46 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |