C17H16F9NO2S — CID 129231107
1-benzyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylmethyl)-3,6-dihydro-2H-pyridine (PubChem CID 129231107) has the molecular formula C17H16F9NO2S and a molecular weight of 469.37 g/mol. Its IUPAC name is 1-benzyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylmethyl)-3,6-dihydro-2H-pyridine.
| Compound Name | 1-benzyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylmethyl)-3,6-dihydro-2H-pyridine |
|---|---|
| PubChem CID | 129231107 |
| Molecular Formula | C17H16F9NO2S |
| Molecular Weight | 469.37 g/mol |
| Exact Mass | 469.08 |
| IUPAC Name | 1-benzyl-5-(1,1,2,2,3,3,4,4,4-nonafluorobutylsulfonylmethyl)-3,6-dihydro-2H-pyridine |
| SMILES | O=S(=O)(CC1=CCCN(Cc2ccccc2)C1)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C17H16F9NO2S/c18-14(19,16(22,23)24)15(20,21)17(25,26)30(28,29)11-13-7-4-8-27(10-13)9-12-5-2-1-3-6-12/h1-3,5-7H,4,8-11H2 |
| InChIKey | SJPDEAWJVAYTGP-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.37 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|