About 8-tert-butyl-3-methyl-3,4-dihydroquinoline
8-tert-butyl-3-methyl-3,4-dihydroquinoline (PubChem CID 129231325) has the molecular formula C14H19N
and a molecular weight of 201.31 g/mol. Its IUPAC name is 8-tert-butyl-3-methyl-3,4-dihydroquinoline.
Molecular Properties
| Compound Name | 8-tert-butyl-3-methyl-3,4-dihydroquinoline |
| PubChem CID | 129231325 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 8-tert-butyl-3-methyl-3,4-dihydroquinoline |
| SMILES | CC1C=Nc2c(cccc2C(C)(C)C)C1 |
| InChI | InChI=1S/C14H19N/c1-10-8-11-6-5-7-12(14(2,3)4)13(11)15-9-10/h5-7,9-10H,8H2,1-4H3 |
| InChIKey | CCFSAEVAHDBCMY-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 8-tert-butyl-3-methyl-3,4-dihydroquinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-tert-butyl-3-methyl-3,4-dihydroquinoline?
The IUPAC name of 8-tert-butyl-3-methyl-3,4-dihydroquinoline (CID 129231325) is 8-tert-butyl-3-methyl-3,4-dihydroquinoline.
What is the SMILES notation for 8-tert-butyl-3-methyl-3,4-dihydroquinoline?
The canonical SMILES for 8-tert-butyl-3-methyl-3,4-dihydroquinoline is CC1C=Nc2c(cccc2C(C)(C)C)C1.
What is the InChIKey of 8-tert-butyl-3-methyl-3,4-dihydroquinoline?
The InChIKey is CCFSAEVAHDBCMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N/c1-10-8-11-6-5-7-12(14(2,3)4)13(11)15-9-10/h5-7,9-10H,8H2,1-4H3.
What are the key properties of 8-tert-butyl-3-methyl-3,4-dihydroquinoline?
8-tert-butyl-3-methyl-3,4-dihydroquinoline has a molecular weight of 201.31 g/mol, XLogP of 3.88, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 8-tert-butyl-3-methyl-3,4-dihydroquinoline is sourced from PubChem (CID 129231325), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).