About N-[(4E,5E)-4,5-di(ethylidene)-2-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]ethanimine
N-[(4E,5E)-4,5-di(ethylidene)-2-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]ethanimine (PubChem CID 129231573) has the molecular formula C13H18N2
and a molecular weight of 202.30 g/mol. Its IUPAC name is N-[(4E,5E)-4,5-di(ethylidene)-2-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]ethanimine.
Molecular Properties
| Compound Name | N-[(4E,5E)-4,5-di(ethylidene)-2-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]ethanimine |
| PubChem CID | 129231573 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | N-[(4E,5E)-4,5-di(ethylidene)-2-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]ethanimine |
| SMILES | C/C=C\c1[nH]c(=C/C)/c(=C\C)c1/N=C/C |
| InChI | InChI=1S/C13H18N2/c1-5-9-12-13(14-8-4)10(6-2)11(7-3)15-12/h5-9,15H,1-4H3/b9-5-,10-6+,11-7+,14-8+ |
| InChIKey | CKCKEFSYEIHSAH-XPNPZVSWSA-N |
| XLogP | 2.37 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze N-[(4E,5E)-4,5-di(ethylidene)-2-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]ethanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4E,5E)-4,5-di(ethylidene)-2-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]ethanimine?
The IUPAC name of N-[(4E,5E)-4,5-di(ethylidene)-2-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]ethanimine (CID 129231573) is N-[(4E,5E)-4,5-di(ethylidene)-2-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]ethanimine.
What is the SMILES notation for N-[(4E,5E)-4,5-di(ethylidene)-2-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]ethanimine?
The canonical SMILES for N-[(4E,5E)-4,5-di(ethylidene)-2-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]ethanimine is C/C=C\c1[nH]c(=C/C)/c(=C\C)c1/N=C/C.
What is the InChIKey of N-[(4E,5E)-4,5-di(ethylidene)-2-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]ethanimine?
The InChIKey is CKCKEFSYEIHSAH-XPNPZVSWSA-N. The full InChI is InChI=1S/C13H18N2/c1-5-9-12-13(14-8-4)10(6-2)11(7-3)15-12/h5-9,15H,1-4H3/b9-5-,10-6+,11-7+,14-8+.
What are the key properties of N-[(4E,5E)-4,5-di(ethylidene)-2-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]ethanimine?
N-[(4E,5E)-4,5-di(ethylidene)-2-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]ethanimine has a molecular weight of 202.30 g/mol, XLogP of 2.37, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4E,5E)-4,5-di(ethylidene)-2-[(Z)-prop-1-enyl]-1H-pyrrol-3-yl]ethanimine is sourced from PubChem (CID 129231573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).