C28H46P+ — CID 129231879
[3-[(2E,4E)-5-ethyl-6,6-dimethylhepta-2,4-dien-2-yl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-trimethylphosphanium (PubChem CID 129231879) has the molecular formula C28H46P+ and a molecular weight of 413.65 g/mol. Its IUPAC name is [3-[(2E,4E)-5-ethyl-6,6-dimethylhepta-2,4-dien-2-yl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-trimethylphosphanium.
| Compound Name | [3-[(2E,4E)-5-ethyl-6,6-dimethylhepta-2,4-dien-2-yl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-trimethylphosphanium |
|---|---|
| PubChem CID | 129231879 |
| Molecular Formula | C28H46P+ |
| Molecular Weight | 413.65 g/mol |
| Exact Mass | 413.33 |
| IUPAC Name | [3-[(2E,4E)-5-ethyl-6,6-dimethylhepta-2,4-dien-2-yl]-5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl]-trimethylphosphanium |
| SMILES | CC/C(=C\C=C(/C)c1cc2c(cc1[P+](C)(C)C)C(C)(C)CCC2(C)C)C(C)(C)C |
| InChI | InChI=1S/C28H46P/c1-13-21(26(3,4)5)15-14-20(2)22-18-23-24(19-25(22)29(10,11)12)28(8,9)17-16-27(23,6)7/h14-15,18-19H,13,16-17H2,1-12H3/q+1/b20-14+,21-15+ |
| InChIKey | DNIZZSNOFIJTKF-OZNQKUEASA-N |
| XLogP | 8.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.65 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|