C20H24F2N6OS — CID 129232005
8-(2,2-difluoroethoxy)-N-[(5S)-8-methyl-3-(3-methyl-1,2-thiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 129232005) has the molecular formula C20H24F2N6OS and a molecular weight of 434.52 g/mol. Its IUPAC name is 8-(2,2-difluoroethoxy)-N-[(5S)-8-methyl-3-(3-methyl-1,2-thiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 8-(2,2-difluoroethoxy)-N-[(5S)-8-methyl-3-(3-methyl-1,2-thiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 129232005 |
| Molecular Formula | C20H24F2N6OS |
| Molecular Weight | 434.52 g/mol |
| Exact Mass | 434.17 |
| IUPAC Name | 8-(2,2-difluoroethoxy)-N-[(5S)-8-methyl-3-(3-methyl-1,2-thiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1cc(N2CC3CC[C@@H](C2)C3(C)Nc2nc3c(OCC(F)F)cccn3n2)sn1 |
| InChI | InChI=1S/C20H24F2N6OS/c1-12-8-17(30-26-12)27-9-13-5-6-14(10-27)20(13,2)24-19-23-18-15(29-11-16(21)22)4-3-7-28(18)25-19/h3-4,7-8,13-14,16H,5-6,9-11H2,1-2H3,(H,24,25)/t13-,14?,20?/m0/s1 |
| InChIKey | YQKTVTNESGDLBQ-LTQQYIGLSA-N |
| XLogP | 3.86 |
| TPSA | 67.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.52 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |