C21H23F3N6O2 — CID 129232172
N-[(5S,6S,7E)-7-ethylidene-3-(3-methyl-1,2-oxazol-5-yl)-3-azabicyclo[3.2.0]heptan-6-yl]-8-(1,1,1-trifluoropropan-2-yloxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 129232172) has the molecular formula C21H23F3N6O2 and a molecular weight of 448.45 g/mol. Its IUPAC name is N-[(5S,6S,7E)-7-ethylidene-3-(3-methyl-1,2-oxazol-5-yl)-3-azabicyclo[3.2.0]heptan-6-yl]-8-(1,1,1-trifluoropropan-2-yloxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-[(5S,6S,7E)-7-ethylidene-3-(3-methyl-1,2-oxazol-5-yl)-3-azabicyclo[3.2.0]heptan-6-yl]-8-(1,1,1-trifluoropropan-2-yloxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 129232172 |
| Molecular Formula | C21H23F3N6O2 |
| Molecular Weight | 448.45 g/mol |
| Exact Mass | 448.18 |
| IUPAC Name | N-[(5S,6S,7E)-7-ethylidene-3-(3-methyl-1,2-oxazol-5-yl)-3-azabicyclo[3.2.0]heptan-6-yl]-8-(1,1,1-trifluoropropan-2-yloxy)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | C/C=C1\C2CN(c3cc(C)no3)C[C@H]2[C@@H]1Nc1nc2c(OC(C)C(F)(F)F)cccn2n1 |
| InChI | InChI=1S/C21H23F3N6O2/c1-4-13-14-9-29(17-8-11(2)28-32-17)10-15(14)18(13)25-20-26-19-16(6-5-7-30(19)27-20)31-12(3)21(22,23)24/h4-8,12,14-15,18H,9-10H2,1-3H3,(H,25,27)/b13-4+/t12?,14?,15-,18-/m1/s1 |
| InChIKey | FSXSQWGXIKKYFG-GOVWNNCLSA-N |
| XLogP | 3.85 |
| TPSA | 80.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|