C13H14F5N5O — CID 129232651
N-(2-methylidenebutyl)-8-(2,2,3,3,3-pentafluoropropoxy)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine (PubChem CID 129232651) has the molecular formula C13H14F5N5O and a molecular weight of 351.28 g/mol. Its IUPAC name is N-(2-methylidenebutyl)-8-(2,2,3,3,3-pentafluoropropoxy)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine.
| Compound Name | N-(2-methylidenebutyl)-8-(2,2,3,3,3-pentafluoropropoxy)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine |
|---|---|
| PubChem CID | 129232651 |
| Molecular Formula | C13H14F5N5O |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 351.11 |
| IUPAC Name | N-(2-methylidenebutyl)-8-(2,2,3,3,3-pentafluoropropoxy)-[1,2,4]triazolo[1,5-a]pyrazin-2-amine |
| SMILES | C=C(CC)CNc1nc2c(OCC(F)(F)C(F)(F)F)nccn2n1 |
| InChI | InChI=1S/C13H14F5N5O/c1-3-8(2)6-20-11-21-9-10(19-4-5-23(9)22-11)24-7-12(14,15)13(16,17)18/h4-5H,2-3,6-7H2,1H3,(H,20,22) |
| InChIKey | FERQFWWKONNPBT-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 64.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|