C21H22F5N7O — CID 129232711
8-(2,2-difluoroethoxy)-N-[(1S,5R)-3-(6-methylpyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 129232711) has the molecular formula C21H22F5N7O and a molecular weight of 483.45 g/mol. Its IUPAC name is 8-(2,2-difluoroethoxy)-N-[(1S,5R)-3-(6-methylpyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 8-(2,2-difluoroethoxy)-N-[(1S,5R)-3-(6-methylpyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 129232711 |
| Molecular Formula | C21H22F5N7O |
| Molecular Weight | 483.45 g/mol |
| Exact Mass | 483.18 |
| IUPAC Name | 8-(2,2-difluoroethoxy)-N-[(1S,5R)-3-(6-methylpyrimidin-4-yl)-3-azabicyclo[3.2.1]octan-8-yl]-5-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1cc(N2C[C@H]3CC[C@@H](C2)C3Nc2nc3c(OCC(F)F)ccc(C(F)(F)F)n3n2)ncn1 |
| InChI | InChI=1S/C21H22F5N7O/c1-11-6-17(28-10-27-11)32-7-12-2-3-13(8-32)18(12)29-20-30-19-14(34-9-16(22)23)4-5-15(21(24,25)26)33(19)31-20/h4-6,10,12-13,16,18H,2-3,7-9H2,1H3,(H,29,31)/t12-,13+,18? |
| InChIKey | SBIKCUDPZRLNAC-NCNPBXTDSA-N |
| XLogP | 3.82 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.45 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |