C21H20F6N6O — CID 129232769
8-(2,2,2-trifluoroethoxy)-N-[(1S,5R)-3-[2-(trifluoromethyl)-4-pyridinyl]-3-azabicyclo[3.2.1]octan-8-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 129232769) has the molecular formula C21H20F6N6O and a molecular weight of 486.42 g/mol. Its IUPAC name is 8-(2,2,2-trifluoroethoxy)-N-[(1S,5R)-3-[2-(trifluoromethyl)-4-pyridinyl]-3-azabicyclo[3.2.1]octan-8-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | 8-(2,2,2-trifluoroethoxy)-N-[(1S,5R)-3-[2-(trifluoromethyl)-4-pyridinyl]-3-azabicyclo[3.2.1]octan-8-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 129232769 |
| Molecular Formula | C21H20F6N6O |
| Molecular Weight | 486.42 g/mol |
| Exact Mass | 486.16 |
| IUPAC Name | 8-(2,2,2-trifluoroethoxy)-N-[(1S,5R)-3-[2-(trifluoromethyl)-4-pyridinyl]-3-azabicyclo[3.2.1]octan-8-yl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | FC(F)(F)COc1cccn2nc(NC3[C@@H]4CC[C@H]3CN(c3ccnc(C(F)(F)F)c3)C4)nc12 |
| InChI | InChI=1S/C21H20F6N6O/c22-20(23,24)11-34-15-2-1-7-33-18(15)30-19(31-33)29-17-12-3-4-13(17)10-32(9-12)14-5-6-28-16(8-14)21(25,26)27/h1-2,5-8,12-13,17H,3-4,9-11H2,(H,29,31)/t12-,13+,17? |
| InChIKey | VHCFIFNXNHPLHF-MPYYAJLASA-N |
| XLogP | 4.41 |
| TPSA | 67.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.42 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |