C16H30O3 — CID 12923297
ethyl (E,3R,7R)-3,7-dimethyl-8-[(2-methylpropan-2-yl)oxy]oct-4-enoate (PubChem CID 12923297) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is ethyl (E,3R,7R)-3,7-dimethyl-8-[(2-methylpropan-2-yl)oxy]oct-4-enoate.
| Compound Name | ethyl (E,3R,7R)-3,7-dimethyl-8-[(2-methylpropan-2-yl)oxy]oct-4-enoate |
|---|---|
| PubChem CID | 12923297 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | ethyl (E,3R,7R)-3,7-dimethyl-8-[(2-methylpropan-2-yl)oxy]oct-4-enoate |
| SMILES | CCOC(=O)C[C@@H](C)/C=C/C[C@@H](C)COC(C)(C)C |
| InChI | InChI=1S/C16H30O3/c1-7-18-15(17)11-13(2)9-8-10-14(3)12-19-16(4,5)6/h8-9,13-14H,7,10-12H2,1-6H3/b9-8+/t13-,14+/m0/s1 |
| InChIKey | ZYYIIEGLFJPSJJ-NYCDYWJRSA-N |
| XLogP | 3.97 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|