C23H25FO2 — CID 129233267
3-[(3E,5E)-5-(3-fluorophenyl)-2-methylocta-1,3,5-trien-3-yl]-4-hydroxybicyclo[3.2.1]oct-3-en-2-one (PubChem CID 129233267) has the molecular formula C23H25FO2 and a molecular weight of 352.45 g/mol. Its IUPAC name is 3-[(3E,5E)-5-(3-fluorophenyl)-2-methylocta-1,3,5-trien-3-yl]-4-hydroxybicyclo[3.2.1]oct-3-en-2-one.
| Compound Name | 3-[(3E,5E)-5-(3-fluorophenyl)-2-methylocta-1,3,5-trien-3-yl]-4-hydroxybicyclo[3.2.1]oct-3-en-2-one |
|---|---|
| PubChem CID | 129233267 |
| Molecular Formula | C23H25FO2 |
| Molecular Weight | 352.45 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 3-[(3E,5E)-5-(3-fluorophenyl)-2-methylocta-1,3,5-trien-3-yl]-4-hydroxybicyclo[3.2.1]oct-3-en-2-one |
| SMILES | C=C(C)/C(=C\C(=C/CC)c1cccc(F)c1)C1=C(O)C2CCC(C2)C1=O |
| InChI | InChI=1S/C23H25FO2/c1-4-6-15(16-7-5-8-19(24)12-16)13-20(14(2)3)21-22(25)17-9-10-18(11-17)23(21)26/h5-8,12-13,17-18,25H,2,4,9-11H2,1,3H3/b15-6+,20-13+ |
| InChIKey | OVJZWJRNFCZJFJ-MHHGNRLASA-N |
| XLogP | 5.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.45 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|