About (6R)-2-(iodomethyl)-3,3-dimethyl-6-[(2R)-4-methylpent-4-en-2-yl]cyclohexan-1-one
(6R)-2-(iodomethyl)-3,3-dimethyl-6-[(2R)-4-methylpent-4-en-2-yl]cyclohexan-1-one (PubChem CID 129233623) has the molecular formula C15H25IO
and a molecular weight of 348.27 g/mol. Its IUPAC name is (6R)-2-(iodomethyl)-3,3-dimethyl-6-[(2R)-4-methylpent-4-en-2-yl]cyclohexan-1-one.
Molecular Properties
| Compound Name | (6R)-2-(iodomethyl)-3,3-dimethyl-6-[(2R)-4-methylpent-4-en-2-yl]cyclohexan-1-one |
| PubChem CID | 129233623 |
| Molecular Formula | C15H25IO |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | (6R)-2-(iodomethyl)-3,3-dimethyl-6-[(2R)-4-methylpent-4-en-2-yl]cyclohexan-1-one |
| SMILES | C=C(C)C[C@@H](C)[C@H]1CCC(C)(C)C(CI)C1=O |
| InChI | InChI=1S/C15H25IO/c1-10(2)8-11(3)12-6-7-15(4,5)13(9-16)14(12)17/h11-13H,1,6-9H2,2-5H3/t11-,12-,13?/m1/s1 |
| InChIKey | MNJFMQWCMLIWSI-ZNRZSNADSA-N |
| XLogP | 4.65 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6R)-2-(iodomethyl)-3,3-dimethyl-6-[(2R)-4-methylpent-4-en-2-yl]cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-2-(iodomethyl)-3,3-dimethyl-6-[(2R)-4-methylpent-4-en-2-yl]cyclohexan-1-one?
The IUPAC name of (6R)-2-(iodomethyl)-3,3-dimethyl-6-[(2R)-4-methylpent-4-en-2-yl]cyclohexan-1-one (CID 129233623) is (6R)-2-(iodomethyl)-3,3-dimethyl-6-[(2R)-4-methylpent-4-en-2-yl]cyclohexan-1-one.
What is the SMILES notation for (6R)-2-(iodomethyl)-3,3-dimethyl-6-[(2R)-4-methylpent-4-en-2-yl]cyclohexan-1-one?
The canonical SMILES for (6R)-2-(iodomethyl)-3,3-dimethyl-6-[(2R)-4-methylpent-4-en-2-yl]cyclohexan-1-one is C=C(C)C[C@@H](C)[C@H]1CCC(C)(C)C(CI)C1=O.
What is the InChIKey of (6R)-2-(iodomethyl)-3,3-dimethyl-6-[(2R)-4-methylpent-4-en-2-yl]cyclohexan-1-one?
The InChIKey is MNJFMQWCMLIWSI-ZNRZSNADSA-N. The full InChI is InChI=1S/C15H25IO/c1-10(2)8-11(3)12-6-7-15(4,5)13(9-16)14(12)17/h11-13H,1,6-9H2,2-5H3/t11-,12-,13?/m1/s1.
What are the key properties of (6R)-2-(iodomethyl)-3,3-dimethyl-6-[(2R)-4-methylpent-4-en-2-yl]cyclohexan-1-one?
(6R)-2-(iodomethyl)-3,3-dimethyl-6-[(2R)-4-methylpent-4-en-2-yl]cyclohexan-1-one has a molecular weight of 348.27 g/mol, XLogP of 4.65, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-2-(iodomethyl)-3,3-dimethyl-6-[(2R)-4-methylpent-4-en-2-yl]cyclohexan-1-one is sourced from PubChem (CID 129233623), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).