About 1-cyano-2-methyl-3-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]guanidine
1-cyano-2-methyl-3-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]guanidine (PubChem CID 12923385) has the molecular formula C9H13N5S2
and a molecular weight of 255.37 g/mol. Its IUPAC name is 1-cyano-2-methyl-3-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]guanidine.
Molecular Properties
| Compound Name | 1-cyano-2-methyl-3-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]guanidine |
| PubChem CID | 12923385 |
| Molecular Formula | C9H13N5S2 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.06 |
| IUPAC Name | 1-cyano-2-methyl-3-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]guanidine |
| SMILES | C/N=C(\NC#N)NCCSCc1nccs1 |
| InChI | InChI=1S/C9H13N5S2/c1-11-9(14-7-10)13-2-4-15-6-8-12-3-5-16-8/h3,5H,2,4,6H2,1H3,(H2,11,13,14) |
| InChIKey | JKMZUDNOTYEUAX-UHFFFAOYSA-N |
| XLogP | 1.02 |
| TPSA | 73.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 1-cyano-2-methyl-3-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyano-2-methyl-3-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]guanidine?
The IUPAC name of 1-cyano-2-methyl-3-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]guanidine (CID 12923385) is 1-cyano-2-methyl-3-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]guanidine.
What is the SMILES notation for 1-cyano-2-methyl-3-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]guanidine?
The canonical SMILES for 1-cyano-2-methyl-3-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]guanidine is C/N=C(\NC#N)NCCSCc1nccs1.
What is the InChIKey of 1-cyano-2-methyl-3-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]guanidine?
The InChIKey is JKMZUDNOTYEUAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13N5S2/c1-11-9(14-7-10)13-2-4-15-6-8-12-3-5-16-8/h3,5H,2,4,6H2,1H3,(H2,11,13,14).
What are the key properties of 1-cyano-2-methyl-3-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]guanidine?
1-cyano-2-methyl-3-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]guanidine has a molecular weight of 255.37 g/mol, XLogP of 1.02, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyano-2-methyl-3-[2-(1,3-thiazol-2-ylmethylsulfanyl)ethyl]guanidine is sourced from PubChem (CID 12923385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).