C30H34N6O3S — CID 129234177
7-(6-cyclopentyloxy-4-methyl-3-pyridinyl)-6-methylidene-N-[(1R,2S)-2-(prop-2-enoylamino)cyclohexyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide (PubChem CID 129234177) has the molecular formula C30H34N6O3S and a molecular weight of 558.71 g/mol. Its IUPAC name is 7-(6-cyclopentyloxy-4-methyl-3-pyridinyl)-6-methylidene-N-[(1R,2S)-2-(prop-2-enoylamino)cyclohexyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide.
| Compound Name | 7-(6-cyclopentyloxy-4-methyl-3-pyridinyl)-6-methylidene-N-[(1R,2S)-2-(prop-2-enoylamino)cyclohexyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 129234177 |
| Molecular Formula | C30H34N6O3S |
| Molecular Weight | 558.71 g/mol |
| Exact Mass | 558.24 |
| IUPAC Name | 7-(6-cyclopentyloxy-4-methyl-3-pyridinyl)-6-methylidene-N-[(1R,2S)-2-(prop-2-enoylamino)cyclohexyl]-2-thia-5,7,11-triazatricyclo[6.3.1.04,12]dodeca-1(11),3,8(12),9-tetraene-3-carboxamide |
| SMILES | C=CC(=O)N[C@H]1CCCC[C@H]1NC(=O)c1sc2nccc3c2c1[nH]c(=C)n3-c1cnc(OC2CCCC2)cc1C |
| InChI | InChI=1S/C30H34N6O3S/c1-4-24(37)34-20-11-7-8-12-21(20)35-29(38)28-27-26-22(13-14-31-30(26)40-28)36(18(3)33-27)23-16-32-25(15-17(23)2)39-19-9-5-6-10-19/h4,13-16,19-21,33H,1,3,5-12H2,2H3,(H,34,37)(H,35,38)/t20-,21+/m0/s1 |
| InChIKey | WCPKEQLESKHAOF-LEWJYISDSA-N |
| XLogP | 4.63 |
| TPSA | 113.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.71 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|