C19H22F3N7OS — CID 129234474
N-[(1S,5R)-3-(3-methyl-1,2,4-thiadiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-[(2S)-1,1,1-trifluoropropan-2-yl]oxy-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 129234474) has the molecular formula C19H22F3N7OS and a molecular weight of 453.49 g/mol. Its IUPAC name is N-[(1S,5R)-3-(3-methyl-1,2,4-thiadiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-[(2S)-1,1,1-trifluoropropan-2-yl]oxy-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-[(1S,5R)-3-(3-methyl-1,2,4-thiadiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-[(2S)-1,1,1-trifluoropropan-2-yl]oxy-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 129234474 |
| Molecular Formula | C19H22F3N7OS |
| Molecular Weight | 453.49 g/mol |
| Exact Mass | 453.16 |
| IUPAC Name | N-[(1S,5R)-3-(3-methyl-1,2,4-thiadiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-[(2S)-1,1,1-trifluoropropan-2-yl]oxy-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1nsc(N2C[C@H]3CC[C@@H](C2)C3Nc2nc3c(O[C@@H](C)C(F)(F)F)cccn3n2)n1 |
| InChI | InChI=1S/C19H22F3N7OS/c1-10(19(20,21)22)30-14-4-3-7-29-16(14)25-17(26-29)24-15-12-5-6-13(15)9-28(8-12)18-23-11(2)27-31-18/h3-4,7,10,12-13,15H,5-6,8-9H2,1-2H3,(H,24,26)/t10-,12-,13+,15?/m0/s1 |
| InChIKey | CRERSSWCJYYZDA-ZOKQIPHBSA-N |
| XLogP | 3.55 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.49 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |