C20H37NO4 — CID 129234537
14-oxo-14-[[(2R)-5-oxohexan-2-yl]amino]tetradecanoic acid (PubChem CID 129234537) has the molecular formula C20H37NO4 and a molecular weight of 355.52 g/mol. Its IUPAC name is 14-oxo-14-[[(2R)-5-oxohexan-2-yl]amino]tetradecanoic acid.
| Compound Name | 14-oxo-14-[[(2R)-5-oxohexan-2-yl]amino]tetradecanoic acid |
|---|---|
| PubChem CID | 129234537 |
| Molecular Formula | C20H37NO4 |
| Molecular Weight | 355.52 g/mol |
| Exact Mass | 355.27 |
| IUPAC Name | 14-oxo-14-[[(2R)-5-oxohexan-2-yl]amino]tetradecanoic acid |
| SMILES | CC(=O)CC[C@@H](C)NC(=O)CCCCCCCCCCCCC(=O)O |
| InChI | InChI=1S/C20H37NO4/c1-17(15-16-18(2)22)21-19(23)13-11-9-7-5-3-4-6-8-10-12-14-20(24)25/h17H,3-16H2,1-2H3,(H,21,23)(H,24,25)/t17-/m1/s1 |
| InChIKey | GBIIGLUFJSLNFX-QGZVFWFLSA-N |
| XLogP | 4.63 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.52 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|