C30H39F2NO5 — CID 129234975
(1S,4S,5R,6R,13S,17R)-4-[[5-(1,1-difluoroethyl)-2-pyridinyl]oxy]-5-hydroxy-3,8,8,14,14,15,17-heptamethyl-7,9-dioxatetracyclo[11.4.1.01,5.06,11]octadeca-2,11-dien-18-one (PubChem CID 129234975) has the molecular formula C30H39F2NO5 and a molecular weight of 531.64 g/mol. Its IUPAC name is (1S,4S,5R,6R,13S,17R)-4-[[5-(1,1-difluoroethyl)-2-pyridinyl]oxy]-5-hydroxy-3,8,8,14,14,15,17-heptamethyl-7,9-dioxatetracyclo[11.4.1.01,5.06,11]octadeca-2,11-dien-18-one.
| Compound Name | (1S,4S,5R,6R,13S,17R)-4-[[5-(1,1-difluoroethyl)-2-pyridinyl]oxy]-5-hydroxy-3,8,8,14,14,15,17-heptamethyl-7,9-dioxatetracyclo[11.4.1.01,5.06,11]octadeca-2,11-dien-18-one |
|---|---|
| PubChem CID | 129234975 |
| Molecular Formula | C30H39F2NO5 |
| Molecular Weight | 531.64 g/mol |
| Exact Mass | 531.28 |
| IUPAC Name | (1S,4S,5R,6R,13S,17R)-4-[[5-(1,1-difluoroethyl)-2-pyridinyl]oxy]-5-hydroxy-3,8,8,14,14,15,17-heptamethyl-7,9-dioxatetracyclo[11.4.1.01,5.06,11]octadeca-2,11-dien-18-one |
| SMILES | CC1=C[C@]23C(=O)[C@@H](C=C4COC(C)(C)O[C@H]4[C@]2(O)[C@H]1Oc1ccc(C(C)(F)F)cn1)C(C)(C)C(C)C[C@H]3C |
| InChI | InChI=1S/C30H39F2NO5/c1-16-13-29-18(3)11-17(2)26(4,5)21(23(29)34)12-19-15-36-27(6,7)38-25(19)30(29,35)24(16)37-22-10-9-20(14-33-22)28(8,31)32/h9-10,12-14,17-18,21,24-25,35H,11,15H2,1-8H3/t17?,18-,21-,24+,25-,29+,30-/m1/s1 |
| InChIKey | BUKZQCNPJJKYJT-ZJKDEODSSA-N |
| XLogP | 5.60 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.64 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|