C30H35F2NO4 — CID 129234978
(1S,6R,13S,18R)-4-[[6-(1,1-difluoroethyl)-2-pyridinyl]oxy]-3,8,8,15,15,18-hexamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,4,11-trien-19-one (PubChem CID 129234978) has the molecular formula C30H35F2NO4 and a molecular weight of 511.61 g/mol. Its IUPAC name is (1S,6R,13S,18R)-4-[[6-(1,1-difluoroethyl)-2-pyridinyl]oxy]-3,8,8,15,15,18-hexamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,4,11-trien-19-one.
| Compound Name | (1S,6R,13S,18R)-4-[[6-(1,1-difluoroethyl)-2-pyridinyl]oxy]-3,8,8,15,15,18-hexamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,4,11-trien-19-one |
|---|---|
| PubChem CID | 129234978 |
| Molecular Formula | C30H35F2NO4 |
| Molecular Weight | 511.61 g/mol |
| Exact Mass | 511.25 |
| IUPAC Name | (1S,6R,13S,18R)-4-[[6-(1,1-difluoroethyl)-2-pyridinyl]oxy]-3,8,8,15,15,18-hexamethyl-7,9-dioxapentacyclo[11.5.1.01,5.06,11.014,16]nonadeca-2,4,11-trien-19-one |
| SMILES | CC1=C[C@]23C(=O)[C@@H](C=C4COC(C)(C)O[C@H]4C2=C1Oc1cccc(C(C)(F)F)n1)C1C(C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C30H35F2NO4/c1-15-13-30-16(2)11-19-22(27(19,3)4)18(26(30)34)12-17-14-35-28(5,6)37-25(17)23(30)24(15)36-21-10-8-9-20(33-21)29(7,31)32/h8-10,12-13,16,18-19,22,25H,11,14H2,1-7H3/t16-,18+,19?,22?,25-,30-/m1/s1 |
| InChIKey | CCGCDRCGCDUCKK-CWRWYGFRSA-N |
| XLogP | 6.36 |
| TPSA | 57.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.61 |
| LogP ≤ 5 | 6.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|