C27H35NO5 — CID 129235125
(4S,5S,6R,9S)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-4-[(3-methyl-2-pyridinyl)oxy]tetracyclo[7.6.1.01,5.010,12]hexadeca-2,7-dien-16-one (PubChem CID 129235125) has the molecular formula C27H35NO5 and a molecular weight of 453.58 g/mol. Its IUPAC name is (4S,5S,6R,9S)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-4-[(3-methyl-2-pyridinyl)oxy]tetracyclo[7.6.1.01,5.010,12]hexadeca-2,7-dien-16-one.
| Compound Name | (4S,5S,6R,9S)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-4-[(3-methyl-2-pyridinyl)oxy]tetracyclo[7.6.1.01,5.010,12]hexadeca-2,7-dien-16-one |
|---|---|
| PubChem CID | 129235125 |
| Molecular Formula | C27H35NO5 |
| Molecular Weight | 453.58 g/mol |
| Exact Mass | 453.25 |
| IUPAC Name | (4S,5S,6R,9S)-5,6-dihydroxy-7-(hydroxymethyl)-3,11,11,14-tetramethyl-4-[(3-methyl-2-pyridinyl)oxy]tetracyclo[7.6.1.01,5.010,12]hexadeca-2,7-dien-16-one |
| SMILES | CC1=CC23CC(C)CC4C([C@H](C=C(CO)[C@@H](O)[C@]2(O)[C@H]1Oc1ncccc1C)C3=O)C4(C)C |
| InChI | InChI=1S/C27H35NO5/c1-14-9-19-20(25(19,4)5)18-10-17(13-29)21(30)27(32)23(33-24-15(2)7-6-8-28-24)16(3)12-26(27,11-14)22(18)31/h6-8,10,12,14,18-21,23,29-30,32H,9,11,13H2,1-5H3/t14?,18-,19?,20?,21+,23-,26?,27-/m0/s1 |
| InChIKey | RVBGDYCJCYCSRR-ATRHZWKESA-N |
| XLogP | 3.00 |
| TPSA | 99.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.58 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|