C10H14Cl2N2O2 — CID 12923518
1-(2,2-dichloroacetyl)-7a-ethyl-2,3,6,7-tetrahydropyrrolo[1,2-a]imidazol-5-one (PubChem CID 12923518) has the molecular formula C10H14Cl2N2O2 and a molecular weight of 265.14 g/mol. Its IUPAC name is 1-(2,2-dichloroacetyl)-7a-ethyl-2,3,6,7-tetrahydropyrrolo[1,2-a]imidazol-5-one.
| Compound Name | 1-(2,2-dichloroacetyl)-7a-ethyl-2,3,6,7-tetrahydropyrrolo[1,2-a]imidazol-5-one |
|---|---|
| PubChem CID | 12923518 |
| Molecular Formula | C10H14Cl2N2O2 |
| Molecular Weight | 265.14 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | 1-(2,2-dichloroacetyl)-7a-ethyl-2,3,6,7-tetrahydropyrrolo[1,2-a]imidazol-5-one |
| SMILES | CCC12CCC(=O)N1CCN2C(=O)C(Cl)Cl |
| InChI | InChI=1S/C10H14Cl2N2O2/c1-2-10-4-3-7(15)13(10)5-6-14(10)9(16)8(11)12/h8H,2-6H2,1H3 |
| InChIKey | VFYOBXHVJLWGBC-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.14 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|