C27H32FNO6 — CID 129235199
(1R,4S,5S,6R,9S,10R,12R,14R)-4-[(4-fluoro-1,2-benzoxazol-3-yl)oxy]-7-(hydroxymethyl)-3,11,11,14-tetramethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-diene-5,6,15-triol (PubChem CID 129235199) has the molecular formula C27H32FNO6 and a molecular weight of 485.55 g/mol. Its IUPAC name is (1R,4S,5S,6R,9S,10R,12R,14R)-4-[(4-fluoro-1,2-benzoxazol-3-yl)oxy]-7-(hydroxymethyl)-3,11,11,14-tetramethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-diene-5,6,15-triol.
| Compound Name | (1R,4S,5S,6R,9S,10R,12R,14R)-4-[(4-fluoro-1,2-benzoxazol-3-yl)oxy]-7-(hydroxymethyl)-3,11,11,14-tetramethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-diene-5,6,15-triol |
|---|---|
| PubChem CID | 129235199 |
| Molecular Formula | C27H32FNO6 |
| Molecular Weight | 485.55 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | (1R,4S,5S,6R,9S,10R,12R,14R)-4-[(4-fluoro-1,2-benzoxazol-3-yl)oxy]-7-(hydroxymethyl)-3,11,11,14-tetramethyltetracyclo[7.5.1.01,5.010,12]pentadeca-2,7-diene-5,6,15-triol |
| SMILES | CC1=C[C@]23C(O)[C@@H](C=C(CO)[C@@H](O)[C@]2(O)[C@H]1Oc1noc2cccc(F)c12)[C@H]1[C@@H](C[C@H]3C)C1(C)C |
| InChI | InChI=1S/C27H32FNO6/c1-12-10-26-13(2)8-16-20(25(16,3)4)15(22(26)32)9-14(11-30)21(31)27(26,33)23(12)34-24-19-17(28)6-5-7-18(19)35-29-24/h5-7,9-10,13,15-16,20-23,30-33H,8,11H2,1-4H3/t13-,15+,16-,20+,21-,22?,23+,26+,27+/m1/s1 |
| InChIKey | GCEUEGJEUHEXKS-CPWJZFKBSA-N |
| XLogP | 2.97 |
| TPSA | 116.18 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.55 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|