C27H32FNO6 — CID 129235203
(13R)-4-[(4-fluoro-1,2-benzoxazol-3-yl)oxy]-5,6-dihydroxy-7-(hydroxymethyl)-3,10,10,11,13-pentamethyltricyclo[7.4.1.01,5]tetradeca-2,7-dien-14-one (PubChem CID 129235203) has the molecular formula C27H32FNO6 and a molecular weight of 485.55 g/mol. Its IUPAC name is (13R)-4-[(4-fluoro-1,2-benzoxazol-3-yl)oxy]-5,6-dihydroxy-7-(hydroxymethyl)-3,10,10,11,13-pentamethyltricyclo[7.4.1.01,5]tetradeca-2,7-dien-14-one.
| Compound Name | (13R)-4-[(4-fluoro-1,2-benzoxazol-3-yl)oxy]-5,6-dihydroxy-7-(hydroxymethyl)-3,10,10,11,13-pentamethyltricyclo[7.4.1.01,5]tetradeca-2,7-dien-14-one |
|---|---|
| PubChem CID | 129235203 |
| Molecular Formula | C27H32FNO6 |
| Molecular Weight | 485.55 g/mol |
| Exact Mass | 485.22 |
| IUPAC Name | (13R)-4-[(4-fluoro-1,2-benzoxazol-3-yl)oxy]-5,6-dihydroxy-7-(hydroxymethyl)-3,10,10,11,13-pentamethyltricyclo[7.4.1.01,5]tetradeca-2,7-dien-14-one |
| SMILES | CC1=CC23C(=O)C(C=C(CO)C(O)C2(O)C1Oc1noc2cccc(F)c12)C(C)(C)C(C)C[C@H]3C |
| InChI | InChI=1S/C27H32FNO6/c1-13-11-26-15(3)9-14(2)25(4,5)17(22(26)32)10-16(12-30)21(31)27(26,33)23(13)34-24-20-18(28)7-6-8-19(20)35-29-24/h6-8,10-11,14-15,17,21,23,30-31,33H,9,12H2,1-5H3/t14?,15-,17?,21?,23?,26?,27?/m1/s1 |
| InChIKey | BPKMHYIQAYAEPH-DEZBILDLSA-N |
| XLogP | 3.57 |
| TPSA | 113.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.55 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|