C12H18Cl2N2O2 — CID 12923523
(8aR)-1-(2,2-dichloroacetyl)-3,3,8a-trimethyl-2,4,7,8-tetrahydropyrrolo[1,2-a]pyrimidin-6-one (PubChem CID 12923523) has the molecular formula C12H18Cl2N2O2 and a molecular weight of 293.19 g/mol. Its IUPAC name is (8aR)-1-(2,2-dichloroacetyl)-3,3,8a-trimethyl-2,4,7,8-tetrahydropyrrolo[1,2-a]pyrimidin-6-one.
| Compound Name | (8aR)-1-(2,2-dichloroacetyl)-3,3,8a-trimethyl-2,4,7,8-tetrahydropyrrolo[1,2-a]pyrimidin-6-one |
|---|---|
| PubChem CID | 12923523 |
| Molecular Formula | C12H18Cl2N2O2 |
| Molecular Weight | 293.19 g/mol |
| Exact Mass | 292.07 |
| IUPAC Name | (8aR)-1-(2,2-dichloroacetyl)-3,3,8a-trimethyl-2,4,7,8-tetrahydropyrrolo[1,2-a]pyrimidin-6-one |
| SMILES | CC1(C)CN2C(=O)CC[C@@]2(C)N(C(=O)C(Cl)Cl)C1 |
| InChI | InChI=1S/C12H18Cl2N2O2/c1-11(2)6-15-8(17)4-5-12(15,3)16(7-11)10(18)9(13)14/h9H,4-7H2,1-3H3/t12-/m1/s1 |
| InChIKey | MHULQDZDXMHODA-GFCCVEGCSA-N |
| XLogP | 2.00 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.19 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|