About (2R,5R)-1-bromo-5-ethoxy-2-methoxy-3,3-dimethylhexane
(2R,5R)-1-bromo-5-ethoxy-2-methoxy-3,3-dimethylhexane (PubChem CID 129235426) has the molecular formula C11H23BrO2
and a molecular weight of 267.21 g/mol. Its IUPAC name is (2R,5R)-1-bromo-5-ethoxy-2-methoxy-3,3-dimethylhexane.
Molecular Properties
| Compound Name | (2R,5R)-1-bromo-5-ethoxy-2-methoxy-3,3-dimethylhexane |
| PubChem CID | 129235426 |
| Molecular Formula | C11H23BrO2 |
| Molecular Weight | 267.21 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | (2R,5R)-1-bromo-5-ethoxy-2-methoxy-3,3-dimethylhexane |
| SMILES | CCO[C@H](C)CC(C)(C)[C@H](CBr)OC |
| InChI | InChI=1S/C11H23BrO2/c1-6-14-9(2)7-11(3,4)10(8-12)13-5/h9-10H,6-8H2,1-5H3/t9-,10+/m1/s1 |
| InChIKey | PBJFQGJGUROFKJ-ZJUUUORDSA-N |
| XLogP | 3.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.21 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2R,5R)-1-bromo-5-ethoxy-2-methoxy-3,3-dimethylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5R)-1-bromo-5-ethoxy-2-methoxy-3,3-dimethylhexane?
The IUPAC name of (2R,5R)-1-bromo-5-ethoxy-2-methoxy-3,3-dimethylhexane (CID 129235426) is (2R,5R)-1-bromo-5-ethoxy-2-methoxy-3,3-dimethylhexane.
What is the SMILES notation for (2R,5R)-1-bromo-5-ethoxy-2-methoxy-3,3-dimethylhexane?
The canonical SMILES for (2R,5R)-1-bromo-5-ethoxy-2-methoxy-3,3-dimethylhexane is CCO[C@H](C)CC(C)(C)[C@H](CBr)OC.
What is the InChIKey of (2R,5R)-1-bromo-5-ethoxy-2-methoxy-3,3-dimethylhexane?
The InChIKey is PBJFQGJGUROFKJ-ZJUUUORDSA-N. The full InChI is InChI=1S/C11H23BrO2/c1-6-14-9(2)7-11(3,4)10(8-12)13-5/h9-10H,6-8H2,1-5H3/t9-,10+/m1/s1.
What are the key properties of (2R,5R)-1-bromo-5-ethoxy-2-methoxy-3,3-dimethylhexane?
(2R,5R)-1-bromo-5-ethoxy-2-methoxy-3,3-dimethylhexane has a molecular weight of 267.21 g/mol, XLogP of 3.24, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5R)-1-bromo-5-ethoxy-2-methoxy-3,3-dimethylhexane is sourced from PubChem (CID 129235426), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).