About (2S,6R)-1-(3-chloropropyl)-2,6-dimethylpiperidine;hydrochloride
(2S,6R)-1-(3-chloropropyl)-2,6-dimethylpiperidine;hydrochloride (PubChem CID 12923592) has the molecular formula C10H21Cl2N
and a molecular weight of 226.19 g/mol. Its IUPAC name is (2S,6R)-1-(3-chloropropyl)-2,6-dimethylpiperidine;hydrochloride.
Molecular Properties
| Compound Name | (2S,6R)-1-(3-chloropropyl)-2,6-dimethylpiperidine;hydrochloride |
| PubChem CID | 12923592 |
| Molecular Formula | C10H21Cl2N |
| Molecular Weight | 226.19 g/mol |
| Exact Mass | 225.11 |
| IUPAC Name | (2S,6R)-1-(3-chloropropyl)-2,6-dimethylpiperidine;hydrochloride |
| SMILES | C[C@@H]1CCC[C@H](C)N1CCCCl.Cl |
| InChI | InChI=1S/C10H20ClN.ClH/c1-9-5-3-6-10(2)12(9)8-4-7-11;/h9-10H,3-8H2,1-2H3;1H/t9-,10+; |
| InChIKey | CEEKMXMGOHQJAL-JMVWIVNTSA-N |
| XLogP | 3.30 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.19 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze (2S,6R)-1-(3-chloropropyl)-2,6-dimethylpiperidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,6R)-1-(3-chloropropyl)-2,6-dimethylpiperidine;hydrochloride?
The IUPAC name of (2S,6R)-1-(3-chloropropyl)-2,6-dimethylpiperidine;hydrochloride (CID 12923592) is (2S,6R)-1-(3-chloropropyl)-2,6-dimethylpiperidine;hydrochloride.
What is the SMILES notation for (2S,6R)-1-(3-chloropropyl)-2,6-dimethylpiperidine;hydrochloride?
The canonical SMILES for (2S,6R)-1-(3-chloropropyl)-2,6-dimethylpiperidine;hydrochloride is C[C@@H]1CCC[C@H](C)N1CCCCl.Cl.
What is the InChIKey of (2S,6R)-1-(3-chloropropyl)-2,6-dimethylpiperidine;hydrochloride?
The InChIKey is CEEKMXMGOHQJAL-JMVWIVNTSA-N. The full InChI is InChI=1S/C10H20ClN.ClH/c1-9-5-3-6-10(2)12(9)8-4-7-11;/h9-10H,3-8H2,1-2H3;1H/t9-,10+;.
What are the key properties of (2S,6R)-1-(3-chloropropyl)-2,6-dimethylpiperidine;hydrochloride?
(2S,6R)-1-(3-chloropropyl)-2,6-dimethylpiperidine;hydrochloride has a molecular weight of 226.19 g/mol, XLogP of 3.30, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,6R)-1-(3-chloropropyl)-2,6-dimethylpiperidine;hydrochloride is sourced from PubChem (CID 12923592), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).