About 3-(5-cyclopropylidenehept-1-en-2-yl)-4,6-dimethyl-1H-indole
3-(5-cyclopropylidenehept-1-en-2-yl)-4,6-dimethyl-1H-indole (PubChem CID 129236227) has the molecular formula C20H25N
and a molecular weight of 279.43 g/mol. Its IUPAC name is 3-(5-cyclopropylidenehept-1-en-2-yl)-4,6-dimethyl-1H-indole.
Molecular Properties
| Compound Name | 3-(5-cyclopropylidenehept-1-en-2-yl)-4,6-dimethyl-1H-indole |
| PubChem CID | 129236227 |
| Molecular Formula | C20H25N |
| Molecular Weight | 279.43 g/mol |
| Exact Mass | 279.20 |
| IUPAC Name | 3-(5-cyclopropylidenehept-1-en-2-yl)-4,6-dimethyl-1H-indole |
| SMILES | C=C(CCC(CC)=C1CC1)c1c[nH]c2cc(C)cc(C)c12 |
| InChI | InChI=1S/C20H25N/c1-5-16(17-8-9-17)7-6-14(3)18-12-21-19-11-13(2)10-15(4)20(18)19/h10-12,21H,3,5-9H2,1-2,4H3 |
| InChIKey | HTEATOWTGDEOJD-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 279.43 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-cyclopropylidenehept-1-en-2-yl)-4,6-dimethyl-1H-indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-cyclopropylidenehept-1-en-2-yl)-4,6-dimethyl-1H-indole?
The IUPAC name of 3-(5-cyclopropylidenehept-1-en-2-yl)-4,6-dimethyl-1H-indole (CID 129236227) is 3-(5-cyclopropylidenehept-1-en-2-yl)-4,6-dimethyl-1H-indole.
What is the SMILES notation for 3-(5-cyclopropylidenehept-1-en-2-yl)-4,6-dimethyl-1H-indole?
The canonical SMILES for 3-(5-cyclopropylidenehept-1-en-2-yl)-4,6-dimethyl-1H-indole is C=C(CCC(CC)=C1CC1)c1c[nH]c2cc(C)cc(C)c12.
What is the InChIKey of 3-(5-cyclopropylidenehept-1-en-2-yl)-4,6-dimethyl-1H-indole?
The InChIKey is HTEATOWTGDEOJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H25N/c1-5-16(17-8-9-17)7-6-14(3)18-12-21-19-11-13(2)10-15(4)20(18)19/h10-12,21H,3,5-9H2,1-2,4H3.
What are the key properties of 3-(5-cyclopropylidenehept-1-en-2-yl)-4,6-dimethyl-1H-indole?
3-(5-cyclopropylidenehept-1-en-2-yl)-4,6-dimethyl-1H-indole has a molecular weight of 279.43 g/mol, XLogP of 6.08, 5 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-cyclopropylidenehept-1-en-2-yl)-4,6-dimethyl-1H-indole is sourced from PubChem (CID 129236227), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).