C18H22N2O3 — CID 129236250
1-azabicyclo[2.2.1]heptan-4-ylmethyl 5-methoxy-4-methyl-1H-indole-3-carboxylate (PubChem CID 129236250) has the molecular formula C18H22N2O3 and a molecular weight of 314.38 g/mol. Its IUPAC name is 1-azabicyclo[2.2.1]heptan-4-ylmethyl 5-methoxy-4-methyl-1H-indole-3-carboxylate.
| Compound Name | 1-azabicyclo[2.2.1]heptan-4-ylmethyl 5-methoxy-4-methyl-1H-indole-3-carboxylate |
|---|---|
| PubChem CID | 129236250 |
| Molecular Formula | C18H22N2O3 |
| Molecular Weight | 314.38 g/mol |
| Exact Mass | 314.16 |
| IUPAC Name | 1-azabicyclo[2.2.1]heptan-4-ylmethyl 5-methoxy-4-methyl-1H-indole-3-carboxylate |
| SMILES | COc1ccc2[nH]cc(C(=O)OCC34CCN(CC3)C4)c2c1C |
| InChI | InChI=1S/C18H22N2O3/c1-12-15(22-2)4-3-14-16(12)13(9-19-14)17(21)23-11-18-5-7-20(10-18)8-6-18/h3-4,9,19H,5-8,10-11H2,1-2H3 |
| InChIKey | LBWYSUDHOLRJSS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |