About 4-(ethenylamino)butyl 4-bromo-6-methoxy-1H-indole-3-carboxylate
4-(ethenylamino)butyl 4-bromo-6-methoxy-1H-indole-3-carboxylate (PubChem CID 129236444) has the molecular formula C16H19BrN2O3
and a molecular weight of 367.24 g/mol. Its IUPAC name is 4-(ethenylamino)butyl 4-bromo-6-methoxy-1H-indole-3-carboxylate.
Molecular Properties
| Compound Name | 4-(ethenylamino)butyl 4-bromo-6-methoxy-1H-indole-3-carboxylate |
| PubChem CID | 129236444 |
| Molecular Formula | C16H19BrN2O3 |
| Molecular Weight | 367.24 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 4-(ethenylamino)butyl 4-bromo-6-methoxy-1H-indole-3-carboxylate |
| SMILES | C=CNCCCCOC(=O)c1c[nH]c2cc(OC)cc(Br)c12 |
| InChI | InChI=1S/C16H19BrN2O3/c1-3-18-6-4-5-7-22-16(20)12-10-19-14-9-11(21-2)8-13(17)15(12)14/h3,8-10,18-19H,1,4-7H2,2H3 |
| InChIKey | LGTAQZCNXPAVTP-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 63.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.24 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(ethenylamino)butyl 4-bromo-6-methoxy-1H-indole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(ethenylamino)butyl 4-bromo-6-methoxy-1H-indole-3-carboxylate?
The IUPAC name of 4-(ethenylamino)butyl 4-bromo-6-methoxy-1H-indole-3-carboxylate (CID 129236444) is 4-(ethenylamino)butyl 4-bromo-6-methoxy-1H-indole-3-carboxylate.
What is the SMILES notation for 4-(ethenylamino)butyl 4-bromo-6-methoxy-1H-indole-3-carboxylate?
The canonical SMILES for 4-(ethenylamino)butyl 4-bromo-6-methoxy-1H-indole-3-carboxylate is C=CNCCCCOC(=O)c1c[nH]c2cc(OC)cc(Br)c12.
What is the InChIKey of 4-(ethenylamino)butyl 4-bromo-6-methoxy-1H-indole-3-carboxylate?
The InChIKey is LGTAQZCNXPAVTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19BrN2O3/c1-3-18-6-4-5-7-22-16(20)12-10-19-14-9-11(21-2)8-13(17)15(12)14/h3,8-10,18-19H,1,4-7H2,2H3.
What are the key properties of 4-(ethenylamino)butyl 4-bromo-6-methoxy-1H-indole-3-carboxylate?
4-(ethenylamino)butyl 4-bromo-6-methoxy-1H-indole-3-carboxylate has a molecular weight of 367.24 g/mol, XLogP of 3.61, 8 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(ethenylamino)butyl 4-bromo-6-methoxy-1H-indole-3-carboxylate is sourced from PubChem (CID 129236444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).