C10H17N — CID 129236531
(1E,3Z)-N,N-dimethylcycloocta-1,3-dien-1-amine (PubChem CID 129236531) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is (1E,3Z)-N,N-dimethylcycloocta-1,3-dien-1-amine.
| Compound Name | (1E,3Z)-N,N-dimethylcycloocta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 129236531 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (1E,3Z)-N,N-dimethylcycloocta-1,3-dien-1-amine |
| SMILES | CN(C)/C1=C/C=C\CCCC1 |
| InChI | InChI=1S/C10H17N/c1-11(2)10-8-6-4-3-5-7-9-10/h4,6,8H,3,5,7,9H2,1-2H3/b6-4-,10-8+ |
| InChIKey | RQLNTKYPUDZXFD-YUFRWXHNSA-N |
| XLogP | 2.56 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |