C15H26N2 — CID 129236613
(4Z,6Z,8Z)-5-(2-iminopropyl)-N,6-dimethyldeca-4,6,8-trien-4-amine (PubChem CID 129236613) has the molecular formula C15H26N2 and a molecular weight of 234.39 g/mol. Its IUPAC name is (4Z,6Z,8Z)-5-(2-iminopropyl)-N,6-dimethyldeca-4,6,8-trien-4-amine.
| Compound Name | (4Z,6Z,8Z)-5-(2-iminopropyl)-N,6-dimethyldeca-4,6,8-trien-4-amine |
|---|---|
| PubChem CID | 129236613 |
| Molecular Formula | C15H26N2 |
| Molecular Weight | 234.39 g/mol |
| Exact Mass | 234.21 |
| IUPAC Name | (4Z,6Z,8Z)-5-(2-iminopropyl)-N,6-dimethyldeca-4,6,8-trien-4-amine |
| SMILES | [H]/N=C(/C)CC(/C(C)=C\C=C/C)=C(\CCC)NC |
| InChI | InChI=1S/C15H26N2/c1-6-8-10-12(3)14(11-13(4)16)15(17-5)9-7-2/h6,8,10,16-17H,7,9,11H2,1-5H3/b8-6-,12-10-,15-14-,16-13- |
| InChIKey | QKSQWWCQMKBAJC-SBCKEULQSA-N |
| XLogP | 4.21 |
| TPSA | 35.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.39 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|