C33H35N7O6S — CID 129236862
N-[2-(dimethylcarbamoyl)-1-benzothiophen-5-yl]-4-[4-[(2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl)oxy]butanoylamino]-1-methylimidazole-2-carboxamide (PubChem CID 129236862) has the molecular formula C33H35N7O6S and a molecular weight of 657.75 g/mol. Its IUPAC name is N-[2-(dimethylcarbamoyl)-1-benzothiophen-5-yl]-4-[4-[(2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl)oxy]butanoylamino]-1-methylimidazole-2-carboxamide.
| Compound Name | N-[2-(dimethylcarbamoyl)-1-benzothiophen-5-yl]-4-[4-[(2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl)oxy]butanoylamino]-1-methylimidazole-2-carboxamide |
|---|---|
| PubChem CID | 129236862 |
| Molecular Formula | C33H35N7O6S |
| Molecular Weight | 657.75 g/mol |
| Exact Mass | 657.24 |
| IUPAC Name | N-[2-(dimethylcarbamoyl)-1-benzothiophen-5-yl]-4-[4-[(2-methoxy-11-oxo-6a,7,8,9-tetrahydropyrrolo[2,1-c][1,4]benzodiazepin-3-yl)oxy]butanoylamino]-1-methylimidazole-2-carboxamide |
| SMILES | COc1cc2c(cc1OCCCC(=O)Nc1cn(C)c(C(=O)Nc3ccc4sc(C(=O)N(C)C)cc4c3)n1)N=CC1CCCN1C2=O |
| InChI | InChI=1S/C33H35N7O6S/c1-38(2)33(44)27-14-19-13-20(9-10-26(19)47-27)35-31(42)30-37-28(18-39(30)3)36-29(41)8-6-12-46-25-16-23-22(15-24(25)45-4)32(43)40-11-5-7-21(40)17-34-23/h9-10,13-18,21H,5-8,11-12H2,1-4H3,(H,35,42)(H,36,41) |
| InChIKey | PHLJPNVRJQMDFJ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 147.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.75 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|