C31H26Cl2N4O4 — CID 129237151
3-chloro-4-[3-[[(2Z)-3-chloro-2-(2-oxoethylidene)pyridine-1-carbonyl]amino]-2-methylphenyl]-7-(2-hydroxypropan-2-yl)-9H-carbazole-1-carboxamide (PubChem CID 129237151) has the molecular formula C31H26Cl2N4O4 and a molecular weight of 589.48 g/mol. Its IUPAC name is 3-chloro-4-[3-[[(2Z)-3-chloro-2-(2-oxoethylidene)pyridine-1-carbonyl]amino]-2-methylphenyl]-7-(2-hydroxypropan-2-yl)-9H-carbazole-1-carboxamide.
| Compound Name | 3-chloro-4-[3-[[(2Z)-3-chloro-2-(2-oxoethylidene)pyridine-1-carbonyl]amino]-2-methylphenyl]-7-(2-hydroxypropan-2-yl)-9H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 129237151 |
| Molecular Formula | C31H26Cl2N4O4 |
| Molecular Weight | 589.48 g/mol |
| Exact Mass | 588.13 |
| IUPAC Name | 3-chloro-4-[3-[[(2Z)-3-chloro-2-(2-oxoethylidene)pyridine-1-carbonyl]amino]-2-methylphenyl]-7-(2-hydroxypropan-2-yl)-9H-carbazole-1-carboxamide |
| SMILES | Cc1c(NC(=O)N2C=CC=C(Cl)/C2=C/C=O)cccc1-c1c(Cl)cc(C(N)=O)c2[nH]c3cc(C(C)(C)O)ccc3c12 |
| InChI | InChI=1S/C31H26Cl2N4O4/c1-16-18(6-4-8-23(16)36-30(40)37-12-5-7-21(32)25(37)11-13-38)26-22(33)15-20(29(34)39)28-27(26)19-10-9-17(31(2,3)41)14-24(19)35-28/h4-15,35,41H,1-3H3,(H2,34,39)(H,36,40)/b25-11- |
| InChIKey | CRKUIWXWBXAXDT-GATIEOLUSA-N |
| XLogP | 6.84 |
| TPSA | 128.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.48 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|