C24H26FN3O3 — CID 129237159
3-fluoro-4-(3-formamido-2-methylphenyl)-7-(2-hydroxypropan-2-yl)-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide (PubChem CID 129237159) has the molecular formula C24H26FN3O3 and a molecular weight of 423.49 g/mol. Its IUPAC name is 3-fluoro-4-(3-formamido-2-methylphenyl)-7-(2-hydroxypropan-2-yl)-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide.
| Compound Name | 3-fluoro-4-(3-formamido-2-methylphenyl)-7-(2-hydroxypropan-2-yl)-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
|---|---|
| PubChem CID | 129237159 |
| Molecular Formula | C24H26FN3O3 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.20 |
| IUPAC Name | 3-fluoro-4-(3-formamido-2-methylphenyl)-7-(2-hydroxypropan-2-yl)-6,7,8,9-tetrahydro-5H-carbazole-1-carboxamide |
| SMILES | Cc1c(NC=O)cccc1-c1c(F)cc(C(N)=O)c2[nH]c3c(c12)CCC(C(C)(C)O)C3 |
| InChI | InChI=1S/C24H26FN3O3/c1-12-14(5-4-6-18(12)27-11-29)20-17(25)10-16(23(26)30)22-21(20)15-8-7-13(24(2,3)31)9-19(15)28-22/h4-6,10-11,13,28,31H,7-9H2,1-3H3,(H2,26,30)(H,27,29) |
| InChIKey | QKEWEUVTZRCCGM-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|