C28H31FN6O3 — CID 129237423
[(3aR,7aR)-1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridin-6-yl]-[2-[1-(cyclopropylmethyl)pyrrolo[2,3-b]pyridin-2-yl]-7-[fluoro(hydroxy)methoxy]-1-methylbenzimidazol-5-yl]methanone (PubChem CID 129237423) has the molecular formula C28H31FN6O3 and a molecular weight of 518.59 g/mol. Its IUPAC name is [(3aR,7aR)-1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridin-6-yl]-[2-[1-(cyclopropylmethyl)pyrrolo[2,3-b]pyridin-2-yl]-7-[fluoro(hydroxy)methoxy]-1-methylbenzimidazol-5-yl]methanone.
| Compound Name | [(3aR,7aR)-1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridin-6-yl]-[2-[1-(cyclopropylmethyl)pyrrolo[2,3-b]pyridin-2-yl]-7-[fluoro(hydroxy)methoxy]-1-methylbenzimidazol-5-yl]methanone |
|---|---|
| PubChem CID | 129237423 |
| Molecular Formula | C28H31FN6O3 |
| Molecular Weight | 518.59 g/mol |
| Exact Mass | 518.24 |
| IUPAC Name | [(3aR,7aR)-1,2,3,3a,4,5,7,7a-octahydropyrrolo[2,3-c]pyridin-6-yl]-[2-[1-(cyclopropylmethyl)pyrrolo[2,3-b]pyridin-2-yl]-7-[fluoro(hydroxy)methoxy]-1-methylbenzimidazol-5-yl]methanone |
| SMILES | Cn1c(-c2cc3cccnc3n2CC2CC2)nc2cc(C(=O)N3CC[C@H]4CCN[C@H]4C3)cc(OC(O)F)c21 |
| InChI | InChI=1S/C28H31FN6O3/c1-33-24-20(32-26(33)22-12-18-3-2-8-31-25(18)35(22)14-16-4-5-16)11-19(13-23(24)38-28(29)37)27(36)34-10-7-17-6-9-30-21(17)15-34/h2-3,8,11-13,16-17,21,28,30,37H,4-7,9-10,14-15H2,1H3/t17-,21+,28?/m1/s1 |
| InChIKey | DTJOLWCNTRJZGG-DGERBDQKSA-N |
| XLogP | 3.45 |
| TPSA | 97.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.59 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|