C8H18N2O — CID 129237634
[(2S,5R)-5-amino-1-ethylpiperidin-2-yl]methanol (PubChem CID 129237634) has the molecular formula C8H18N2O and a molecular weight of 158.24 g/mol. Its IUPAC name is [(2S,5R)-5-amino-1-ethylpiperidin-2-yl]methanol.
| Compound Name | [(2S,5R)-5-amino-1-ethylpiperidin-2-yl]methanol |
|---|---|
| PubChem CID | 129237634 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | [(2S,5R)-5-amino-1-ethylpiperidin-2-yl]methanol |
| SMILES | CCN1C[C@H](N)CC[C@H]1CO |
| InChI | InChI=1S/C8H18N2O/c1-2-10-5-7(9)3-4-8(10)6-11/h7-8,11H,2-6,9H2,1H3/t7-,8+/m1/s1 |
| InChIKey | VEOZDCWTDPFHGB-SFYZADRCSA-N |
| XLogP | -0.21 |
| TPSA | 49.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |