C15H24OS — CID 129237755
(5Z,7Z)-5-ethenyl-8,9-dimethyl-3-methylsulfanyldeca-1,5,7-trien-2-ol (PubChem CID 129237755) has the molecular formula C15H24OS and a molecular weight of 252.42 g/mol. Its IUPAC name is (5Z,7Z)-5-ethenyl-8,9-dimethyl-3-methylsulfanyldeca-1,5,7-trien-2-ol.
| Compound Name | (5Z,7Z)-5-ethenyl-8,9-dimethyl-3-methylsulfanyldeca-1,5,7-trien-2-ol |
|---|---|
| PubChem CID | 129237755 |
| Molecular Formula | C15H24OS |
| Molecular Weight | 252.42 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | (5Z,7Z)-5-ethenyl-8,9-dimethyl-3-methylsulfanyldeca-1,5,7-trien-2-ol |
| SMILES | C=C/C(=C\C=C(\C)C(C)C)CC(SC)C(=C)O |
| InChI | InChI=1S/C15H24OS/c1-7-14(9-8-12(4)11(2)3)10-15(17-6)13(5)16/h7-9,11,15-16H,1,5,10H2,2-4,6H3/b12-8-,14-9+ |
| InChIKey | POPTXAIEOSOEDL-WNEGCBGQSA-N |
| XLogP | 4.89 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.42 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|