C19H27N — CID 129237976
(3E,8Z,10Z)-7-ethyl-6,6-dimethyl-4-[(3Z)-penta-1,3-dien-3-yl]-1-azacycloundeca-1,3,8,10-tetraene (PubChem CID 129237976) has the molecular formula C19H27N and a molecular weight of 269.43 g/mol. Its IUPAC name is (3E,8Z,10Z)-7-ethyl-6,6-dimethyl-4-[(3Z)-penta-1,3-dien-3-yl]-1-azacycloundeca-1,3,8,10-tetraene.
| Compound Name | (3E,8Z,10Z)-7-ethyl-6,6-dimethyl-4-[(3Z)-penta-1,3-dien-3-yl]-1-azacycloundeca-1,3,8,10-tetraene |
|---|---|
| PubChem CID | 129237976 |
| Molecular Formula | C19H27N |
| Molecular Weight | 269.43 g/mol |
| Exact Mass | 269.21 |
| IUPAC Name | (3E,8Z,10Z)-7-ethyl-6,6-dimethyl-4-[(3Z)-penta-1,3-dien-3-yl]-1-azacycloundeca-1,3,8,10-tetraene |
| SMILES | C=CC(=C/C)/C1=C/C=N\C=C/C=C\C(CC)C(C)(C)C1 |
| InChI | InChI=1S/C19H27N/c1-6-16(7-2)17-12-14-20-13-10-9-11-18(8-3)19(4,5)15-17/h6-7,9-14,18H,1,8,15H2,2-5H3/b11-9-,13-10-,16-7-,17-12+,20-14- |
| InChIKey | ZOININMSXXKZJM-QCQVIKFASA-N |
| XLogP | 5.64 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.43 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|