C9H16N2 — CID 129238037
(1R,3E)-1-methylcycloocta-3,7-diene-1,3-diamine (PubChem CID 129238037) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is (1R,3E)-1-methylcycloocta-3,7-diene-1,3-diamine.
| Compound Name | (1R,3E)-1-methylcycloocta-3,7-diene-1,3-diamine |
|---|---|
| PubChem CID | 129238037 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (1R,3E)-1-methylcycloocta-3,7-diene-1,3-diamine |
| SMILES | C[C@]1(N)C=CCC/C=C(/N)C1 |
| InChI | InChI=1S/C9H16N2/c1-9(11)6-4-2-3-5-8(10)7-9/h4-6H,2-3,7,10-11H2,1H3/b6-4?,8-5+/t9-/m0/s1 |
| InChIKey | WGTDTRLJDATONL-NFOMOJAJSA-N |
| XLogP | 1.29 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|