C10H12F5N3O — CID 129238178
N-cyclohexyl-3-(1,1,2,2,2-pentafluoroethyl)-1,2,4-oxadiazol-5-amine (PubChem CID 129238178) has the molecular formula C10H12F5N3O and a molecular weight of 285.22 g/mol. Its IUPAC name is N-cyclohexyl-3-(1,1,2,2,2-pentafluoroethyl)-1,2,4-oxadiazol-5-amine.
| Compound Name | N-cyclohexyl-3-(1,1,2,2,2-pentafluoroethyl)-1,2,4-oxadiazol-5-amine |
|---|---|
| PubChem CID | 129238178 |
| Molecular Formula | C10H12F5N3O |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 285.09 |
| IUPAC Name | N-cyclohexyl-3-(1,1,2,2,2-pentafluoroethyl)-1,2,4-oxadiazol-5-amine |
| SMILES | FC(F)(F)C(F)(F)c1noc(NC2CCCCC2)n1 |
| InChI | InChI=1S/C10H12F5N3O/c11-9(12,10(13,14)15)7-17-8(19-18-7)16-6-4-2-1-3-5-6/h6H,1-5H2,(H,16,17,18) |
| InChIKey | BZQZAMMDHNTZHI-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|