About 4-cyclooctylbenzaldehyde
4-cyclooctylbenzaldehyde (PubChem CID 12923818) has the molecular formula C15H20O
and a molecular weight of 216.32 g/mol. Its IUPAC name is 4-cyclooctylbenzaldehyde.
Molecular Properties
| Compound Name | 4-cyclooctylbenzaldehyde |
| PubChem CID | 12923818 |
| Molecular Formula | C15H20O |
| Molecular Weight | 216.32 g/mol |
| Exact Mass | 216.15 |
| IUPAC Name | 4-cyclooctylbenzaldehyde |
| SMILES | O=Cc1ccc(C2CCCCCCC2)cc1 |
| InChI | InChI=1S/C15H20O/c16-12-13-8-10-15(11-9-13)14-6-4-2-1-3-5-7-14/h8-12,14H,1-7H2 |
| InChIKey | FVHGAEYKDBJJIF-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.32 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 4-cyclooctylbenzaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-cyclooctylbenzaldehyde?
The IUPAC name of 4-cyclooctylbenzaldehyde (CID 12923818) is 4-cyclooctylbenzaldehyde.
What is the SMILES notation for 4-cyclooctylbenzaldehyde?
The canonical SMILES for 4-cyclooctylbenzaldehyde is O=Cc1ccc(C2CCCCCCC2)cc1.
What is the InChIKey of 4-cyclooctylbenzaldehyde?
The InChIKey is FVHGAEYKDBJJIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H20O/c16-12-13-8-10-15(11-9-13)14-6-4-2-1-3-5-7-14/h8-12,14H,1-7H2.
What are the key properties of 4-cyclooctylbenzaldehyde?
4-cyclooctylbenzaldehyde has a molecular weight of 216.32 g/mol, XLogP of 4.33, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-cyclooctylbenzaldehyde is sourced from PubChem (CID 12923818), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).