About 3-(5-methylcyclohexa-1,3-dien-1-yl)diaziridine
3-(5-methylcyclohexa-1,3-dien-1-yl)diaziridine (PubChem CID 129238367) has the molecular formula C8H12N2
and a molecular weight of 136.20 g/mol. Its IUPAC name is 3-(5-methylcyclohexa-1,3-dien-1-yl)diaziridine.
Molecular Properties
| Compound Name | 3-(5-methylcyclohexa-1,3-dien-1-yl)diaziridine |
| PubChem CID | 129238367 |
| Molecular Formula | C8H12N2 |
| Molecular Weight | 136.20 g/mol |
| Exact Mass | 136.10 |
| IUPAC Name | 3-(5-methylcyclohexa-1,3-dien-1-yl)diaziridine |
| SMILES | CC1C=CC=C(C2NN2)C1 |
| InChI | InChI=1S/C8H12N2/c1-6-3-2-4-7(5-6)8-9-10-8/h2-4,6,8-10H,5H2,1H3 |
| InChIKey | IBKCGCGGZONSJI-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 43.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.20 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-(5-methylcyclohexa-1,3-dien-1-yl)diaziridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-methylcyclohexa-1,3-dien-1-yl)diaziridine?
The IUPAC name of 3-(5-methylcyclohexa-1,3-dien-1-yl)diaziridine (CID 129238367) is 3-(5-methylcyclohexa-1,3-dien-1-yl)diaziridine.
What is the SMILES notation for 3-(5-methylcyclohexa-1,3-dien-1-yl)diaziridine?
The canonical SMILES for 3-(5-methylcyclohexa-1,3-dien-1-yl)diaziridine is CC1C=CC=C(C2NN2)C1.
What is the InChIKey of 3-(5-methylcyclohexa-1,3-dien-1-yl)diaziridine?
The InChIKey is IBKCGCGGZONSJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N2/c1-6-3-2-4-7(5-6)8-9-10-8/h2-4,6,8-10H,5H2,1H3.
What are the key properties of 3-(5-methylcyclohexa-1,3-dien-1-yl)diaziridine?
3-(5-methylcyclohexa-1,3-dien-1-yl)diaziridine has a molecular weight of 136.20 g/mol, XLogP of 0.94, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-methylcyclohexa-1,3-dien-1-yl)diaziridine is sourced from PubChem (CID 129238367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).