C10H15N — CID 129238576
7-methyl-4a,5,6,7,8,8a-hexahydroquinoline (PubChem CID 129238576) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is 7-methyl-4a,5,6,7,8,8a-hexahydroquinoline.
| Compound Name | 7-methyl-4a,5,6,7,8,8a-hexahydroquinoline |
|---|---|
| PubChem CID | 129238576 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 7-methyl-4a,5,6,7,8,8a-hexahydroquinoline |
| SMILES | CC1CCC2C=CC=NC2C1 |
| InChI | InChI=1S/C10H15N/c1-8-4-5-9-3-2-6-11-10(9)7-8/h2-3,6,8-10H,4-5,7H2,1H3 |
| InChIKey | HEUBRNLLNQFTSX-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |