C8H10N2S — CID 129238579
5,6,7,8-tetrahydro-2H-2,6-naphthyridine-3-thione (PubChem CID 129238579) has the molecular formula C8H10N2S and a molecular weight of 166.25 g/mol. Its IUPAC name is 5,6,7,8-tetrahydro-2H-2,6-naphthyridine-3-thione.
| Compound Name | 5,6,7,8-tetrahydro-2H-2,6-naphthyridine-3-thione |
|---|---|
| PubChem CID | 129238579 |
| Molecular Formula | C8H10N2S |
| Molecular Weight | 166.25 g/mol |
| Exact Mass | 166.06 |
| IUPAC Name | 5,6,7,8-tetrahydro-2H-2,6-naphthyridine-3-thione |
| SMILES | S=c1cc2c(c[nH]1)CCNC2 |
| InChI | InChI=1S/C8H10N2S/c11-8-3-7-4-9-2-1-6(7)5-10-8/h3,5,9H,1-2,4H2,(H,10,11) |
| InChIKey | GTKOPNFQUOTFIC-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 27.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.25 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|